Fosaprepitant

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 416448532 | image = Fosaprepitant.svg | alt = Skeletal formula of fosaprepitant | width = 255 | image2 = Fosaprepitant-3D-spacefill.png | alt2 = Space-filling model of the fosaprepitant molecule | tradename = Emend, Ivemend | Drugs.com = Professional Drug Facts | MedlinePlus = a604003 | licence_EU = yes | DailyMedID = Fosaprepitant | licence_US = Fosaprepitant | pregnancy_AU = B2 | pregnancy_US = N | pregnancy_category = | legal_AU = S4 | legal_CA = | legal_UK = POM | legal_US = Rx-only | routes_of_administration = Intravenous | ATC_prefix = A04 | ATC_suffix = AD12 | bioavailability = n/a | protein_bound = >95% (aprepitant) | metabolism = To aprepitant | elimination_half-life = 9 to 13 hours (aprepitant) | excretion = | IUPHAR_ligand = 7623 | CAS_number_Ref =  Y | CAS_number = 172673-20-0 | CAS_supplemental =
265121-04-8 (dimeglumine) | PubChem = 219090 | DrugBank_Ref =  N | DrugBank = DB06717 | UNII_Ref =  N | UNII = 6L8OF9XRDC | KEGG_Ref =  N | KEGG = D06597 | ChEMBL_Ref =  N | ChEMBL = 1199324 | ChEBI_Ref =  N | ChEBI = 64321 | ChemSpiderID_Ref =  N | ChemSpiderID = 189912 | IUPAC_name = [3-{[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl] ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl}-5-oxo- 2H-1,2,4-triazol-1-yl]phosphonic acid | C=23 | H=22 | F=7 | N=4 | O=6 | P=1 | smiles = C[C@H](c1cc(cc(c1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](N(CCO2)Cc3[nH]c(=O)n(n3)P(=O)(O)O)c4ccc(cc4)F | StdInChI_Ref =  N | StdInChI = 1S/C23H22F7N4O6P/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)40-20-19(13-2-4-17(24)5-3-13)33(6-7-39-20)11-18-31-21(35)34(32-18)41(36,37)38/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H,31,32,35)(H2,36,37,38)/t12-,19+,20-/m1/s1 | StdInChIKey_Ref =  N | StdInChIKey = BARDROPHSZEBKC-OITMNORJSA-N }}

Fosaprepitant (Emend for Injection (US), Ivemend (EU)) is an antiemetic medication, administered intravenously. It is a prodrug of aprepitant.

Fosaprepitant was developed by Merck & Co. and was approved by the U.S. Food and Drug Administration (FDA) on January 25, 2008,[1] and by the European Medicines Agency (EMA) on January 11 of the same year.[2]

References
  1. "Drugs.com, FDA Approves Emend (fosaprepitant dimeglumine) for Injection, Merck's New Intravenous Therapy, for Use in Combination with Other Antiemetics for Prevention of Nausea and Vomiting Caused by Chemotherapy". Retrieved 2008-03-15.
  2. "European Public Assessment Report for Ivemend (from the EMEA website)". Archived from the original on 2008-02-28. Retrieved 2008-03-15.


This article is issued from Wikipedia. The text is licensed under Creative Commons - Attribution - Sharealike. Additional terms may apply for the media files.